C25H26N6O2 — CID 66570879
2-(oxan-4-yloxy)-5-[2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]pyrimidin-4-yl]benzonitrile (PubChem CID 66570879) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(oxan-4-yloxy)-5-[2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-(oxan-4-yloxy)-5-[2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 66570879 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-(oxan-4-yloxy)-5-[2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N4CCCC4)nc3)n2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C25H26N6O2/c26-16-19-15-18(3-5-23(19)33-21-8-13-32-14-9-21)22-7-10-27-25(30-22)29-20-4-6-24(28-17-20)31-11-1-2-12-31/h3-7,10,15,17,21H,1-2,8-9,11-14H2,(H,27,29,30) |
| InChIKey | HRJNMIXJSGCBIB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |