C22H20N4O3 — CID 72944581
(E)-3-[3-[3-cyano-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide (PubChem CID 72944581) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is (E)-3-[3-[3-cyano-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide.
| Compound Name | (E)-3-[3-[3-cyano-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 72944581 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (E)-3-[3-[3-cyano-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
| SMILES | N#Cc1cc(-c2c[nH]c3ncc(/C=C/C(N)=O)cc23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C22H20N4O3/c23-11-16-10-15(2-3-20(16)29-17-5-7-28-8-6-17)19-13-26-22-18(19)9-14(12-25-22)1-4-21(24)27/h1-4,9-10,12-13,17H,5-8H2,(H2,24,27)(H,25,26)/b4-1+ |
| InChIKey | CMJRRKADXGCDMI-DAFODLJHSA-N |
| XLogP | 3.16 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|