C26H26N4O3 — CID 72944579
2-(oxan-4-yloxy)-5-[5-[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzonitrile (PubChem CID 72944579) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(oxan-4-yloxy)-5-[5-[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzonitrile.
| Compound Name | 2-(oxan-4-yloxy)-5-[5-[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 72944579 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(oxan-4-yloxy)-5-[5-[(E)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2c[nH]c3ncc(/C=C/C(=O)N4CCCC4)cc23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C26H26N4O3/c27-15-20-14-19(4-5-24(20)33-21-7-11-32-12-8-21)23-17-29-26-22(23)13-18(16-28-26)3-6-25(31)30-9-1-2-10-30/h3-6,13-14,16-17,21H,1-2,7-12H2,(H,28,29)/b6-3+ |
| InChIKey | KCBQNVQHWGJPDD-ZZXKWVIFSA-N |
| XLogP | 4.29 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|