C21H22N6O — CID 25097514
9-(1-methylpyrazol-4-yl)-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25097514) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 9-(1-methylpyrazol-4-yl)-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-(1-methylpyrazol-4-yl)-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25097514 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 9-(1-methylpyrazol-4-yl)-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | Cn1cc(-c2ccc3c(N[C@H]4CCCNC4)nc4cc[nH]c(=O)c4c3c2)cn1 |
| InChI | InChI=1S/C21H22N6O/c1-27-12-14(10-24-27)13-4-5-16-17(9-13)19-18(6-8-23-21(19)28)26-20(16)25-15-3-2-7-22-11-15/h4-6,8-10,12,15,22H,2-3,7,11H2,1H3,(H,23,28)(H,25,26)/t15-/m0/s1 |
| InChIKey | ZLMVNKNLJZLLOL-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|