C24H19Cl2N5O2 — CID 59435995
5-[2,6-dichloro-4-[(1S)-1-hydroxyethyl]anilino]-9-(1-methylpyrazol-4-yl)-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 59435995) has the molecular formula C24H19Cl2N5O2 and a molecular weight of 480.36 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-[(1S)-1-hydroxyethyl]anilino]-9-(1-methylpyrazol-4-yl)-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 5-[2,6-dichloro-4-[(1S)-1-hydroxyethyl]anilino]-9-(1-methylpyrazol-4-yl)-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59435995 |
| Molecular Formula | C24H19Cl2N5O2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 5-[2,6-dichloro-4-[(1S)-1-hydroxyethyl]anilino]-9-(1-methylpyrazol-4-yl)-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | C[C@H](O)c1cc(Cl)c(Nc2nc3ccc(-c4cnn(C)c4)cc3c3c(=O)[nH]ccc23)c(Cl)c1 |
| InChI | InChI=1S/C24H19Cl2N5O2/c1-12(32)14-8-18(25)22(19(26)9-14)30-23-16-5-6-27-24(33)21(16)17-7-13(3-4-20(17)29-23)15-10-28-31(2)11-15/h3-12,32H,1-2H3,(H,27,33)(H,29,30)/t12-/m0/s1 |
| InChIKey | JUXVYFPXOISOAX-LBPRGKRZSA-N |
| XLogP | 5.58 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|