C18H15N5O — CID 66887497
8-anilino-5-(1-methylpyrazol-4-yl)-2H-2,7-naphthyridin-1-one (PubChem CID 66887497) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 8-anilino-5-(1-methylpyrazol-4-yl)-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-anilino-5-(1-methylpyrazol-4-yl)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 66887497 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 8-anilino-5-(1-methylpyrazol-4-yl)-2H-2,7-naphthyridin-1-one |
| SMILES | Cn1cc(-c2cnc(Nc3ccccc3)c3c(=O)[nH]ccc23)cn1 |
| InChI | InChI=1S/C18H15N5O/c1-23-11-12(9-21-23)15-10-20-17(22-13-5-3-2-4-6-13)16-14(15)7-8-19-18(16)24/h2-11H,1H3,(H,19,24)(H,20,22) |
| InChIKey | MOPWORVLZXCQNC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |