C19H13N3O3 — CID 87192134
5-(1-anilino-8-oxo-7H-2,7-naphthyridin-4-yl)furan-2-carbaldehyde (PubChem CID 87192134) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 5-(1-anilino-8-oxo-7H-2,7-naphthyridin-4-yl)furan-2-carbaldehyde.
| Compound Name | 5-(1-anilino-8-oxo-7H-2,7-naphthyridin-4-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 87192134 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-(1-anilino-8-oxo-7H-2,7-naphthyridin-4-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cnc(Nc3ccccc3)c3c(=O)[nH]ccc23)o1 |
| InChI | InChI=1S/C19H13N3O3/c23-11-13-6-7-16(25-13)15-10-21-18(22-12-4-2-1-3-5-12)17-14(15)8-9-20-19(17)24/h1-11H,(H,20,24)(H,21,22) |
| InChIKey | XHVCARSMZZIWRQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|