C19H12N2O3 — CID 169332653
5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169332653) has the molecular formula C19H12N2O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169332653 |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccccc2-c2nc(-c3ccccc3)no2)o1 |
| InChI | InChI=1S/C19H12N2O3/c22-12-14-10-11-17(23-14)15-8-4-5-9-16(15)19-20-18(21-24-19)13-6-2-1-3-7-13/h1-12H |
| InChIKey | ISZMMRGWQBJOBT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|