C21H17N3O — CID 174612331
8-anilino-5-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde (PubChem CID 174612331) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 8-anilino-5-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde.
| Compound Name | 8-anilino-5-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174612331 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 8-anilino-5-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
| SMILES | O=CC1NC=Cc2c(-c3ccccc3)cnc(Nc3ccccc3)c21 |
| InChI | InChI=1S/C21H17N3O/c25-14-19-20-17(11-12-22-19)18(15-7-3-1-4-8-15)13-23-21(20)24-16-9-5-2-6-10-16/h1-14,19,22H,(H,23,24) |
| InChIKey | XTKBYARUZLRBSZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|