C17H15N3 — CID 59346194
2-N,4-diphenylpyridine-2,3-diamine (PubChem CID 59346194) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-N,4-diphenylpyridine-2,3-diamine.
| Compound Name | 2-N,4-diphenylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 59346194 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-N,4-diphenylpyridine-2,3-diamine |
| SMILES | Nc1c(-c2ccccc2)ccnc1Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3/c18-16-15(13-7-3-1-4-8-13)11-12-19-17(16)20-14-9-5-2-6-10-14/h1-12H,18H2,(H,19,20) |
| InChIKey | NVOWGRQOTBJXMG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |