About 4-bromo-N,3-diphenylpyridin-2-amine
4-bromo-N,3-diphenylpyridin-2-amine (PubChem CID 67535365) has the molecular formula C17H13BrN2
and a molecular weight of 325.21 g/mol. Its IUPAC name is 4-bromo-N,3-diphenylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N,3-diphenylpyridin-2-amine |
| PubChem CID | 67535365 |
| Molecular Formula | C17H13BrN2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-bromo-N,3-diphenylpyridin-2-amine |
| SMILES | Brc1ccnc(Nc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H13BrN2/c18-15-11-12-19-17(20-14-9-5-2-6-10-14)16(15)13-7-3-1-4-8-13/h1-12H,(H,19,20) |
| InChIKey | FUGUWFSQXFZDKD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N,3-diphenylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,3-diphenylpyridin-2-amine?
The IUPAC name of 4-bromo-N,3-diphenylpyridin-2-amine (CID 67535365) is 4-bromo-N,3-diphenylpyridin-2-amine.
What is the SMILES notation for 4-bromo-N,3-diphenylpyridin-2-amine?
The canonical SMILES for 4-bromo-N,3-diphenylpyridin-2-amine is Brc1ccnc(Nc2ccccc2)c1-c1ccccc1.
What is the InChIKey of 4-bromo-N,3-diphenylpyridin-2-amine?
The InChIKey is FUGUWFSQXFZDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2/c18-15-11-12-19-17(20-14-9-5-2-6-10-14)16(15)13-7-3-1-4-8-13/h1-12H,(H,19,20).
What are the key properties of 4-bromo-N,3-diphenylpyridin-2-amine?
4-bromo-N,3-diphenylpyridin-2-amine has a molecular weight of 325.21 g/mol, XLogP of 5.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,3-diphenylpyridin-2-amine is sourced from PubChem (CID 67535365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).