C17H15N3 — CID 19842106
(3,4-diphenyl-2-pyridinyl)hydrazine (PubChem CID 19842106) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is (3,4-diphenyl-2-pyridinyl)hydrazine.
| Compound Name | (3,4-diphenyl-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 19842106 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (3,4-diphenyl-2-pyridinyl)hydrazine |
| SMILES | NNc1nccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H15N3/c18-20-17-16(14-9-5-2-6-10-14)15(11-12-19-17)13-7-3-1-4-8-13/h1-12H,18H2,(H,19,20) |
| InChIKey | JGXVLAOUBYBVAG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|