C16H22N6 — CID 86740554
4-[3-(dimethylamino)propyl]-2-N-phenylpyridine-2,3-diamine;molecular nitrogen (PubChem CID 86740554) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl]-2-N-phenylpyridine-2,3-diamine;molecular nitrogen.
| Compound Name | 4-[3-(dimethylamino)propyl]-2-N-phenylpyridine-2,3-diamine;molecular nitrogen |
|---|---|
| PubChem CID | 86740554 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-[3-(dimethylamino)propyl]-2-N-phenylpyridine-2,3-diamine;molecular nitrogen |
| SMILES | CN(C)CCCc1ccnc(Nc2ccccc2)c1N.N#N |
| InChI | InChI=1S/C16H22N4.N2/c1-20(2)12-6-7-13-10-11-18-16(15(13)17)19-14-8-4-3-5-9-14;1-2/h3-5,8-11H,6-7,12,17H2,1-2H3,(H,18,19); |
| InChIKey | AAOKYUMUKUHZEP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|