C15H20N2 — CID 19734899
2-[3-(dimethylamino)propyl]naphthalen-1-amine (PubChem CID 19734899) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]naphthalen-1-amine.
| Compound Name | 2-[3-(dimethylamino)propyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 19734899 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]naphthalen-1-amine |
| SMILES | CN(C)CCCc1ccc2ccccc2c1N |
| InChI | InChI=1S/C15H20N2/c1-17(2)11-5-7-13-10-9-12-6-3-4-8-14(12)15(13)16/h3-4,6,8-10H,5,7,11,16H2,1-2H3 |
| InChIKey | QJWFSQBDTOVNCY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|