C16H21NO — CID 170865305
3-(2-methoxynaphthalen-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 170865305) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-(2-methoxynaphthalen-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-methoxynaphthalen-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865305 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3-(2-methoxynaphthalen-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2ccccc2c1CCCN(C)C |
| InChI | InChI=1S/C16H21NO/c1-17(2)12-6-9-15-14-8-5-4-7-13(14)10-11-16(15)18-3/h4-5,7-8,10-11H,6,9,12H2,1-3H3 |
| InChIKey | LIMUQQAFBBYRPR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |