C15H18O3 — CID 82185801
4-(2-methoxynaphthalen-1-yl)butane-1,2-diol (PubChem CID 82185801) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-(2-methoxynaphthalen-1-yl)butane-1,2-diol.
| Compound Name | 4-(2-methoxynaphthalen-1-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 82185801 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 4-(2-methoxynaphthalen-1-yl)butane-1,2-diol |
| SMILES | COc1ccc2ccccc2c1CCC(O)CO |
| InChI | InChI=1S/C15H18O3/c1-18-15-9-6-11-4-2-3-5-13(11)14(15)8-7-12(17)10-16/h2-6,9,12,16-17H,7-8,10H2,1H3 |
| InChIKey | JFIBICHPTSMCFG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |