C17H17NO6 — CID 67611600
2-[3-(2-methoxynaphthalen-1-yl)propanoylamino]propanedioic acid (PubChem CID 67611600) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-[3-(2-methoxynaphthalen-1-yl)propanoylamino]propanedioic acid.
| Compound Name | 2-[3-(2-methoxynaphthalen-1-yl)propanoylamino]propanedioic acid |
|---|---|
| PubChem CID | 67611600 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[3-(2-methoxynaphthalen-1-yl)propanoylamino]propanedioic acid |
| SMILES | COc1ccc2ccccc2c1CCC(=O)NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H17NO6/c1-24-13-8-6-10-4-2-3-5-11(10)12(13)7-9-14(19)18-15(16(20)21)17(22)23/h2-6,8,15H,7,9H2,1H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | IKBKZDYFGJPRIG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|