C21H30N2O — CID 21127174
2-[2-[4-(dimethylamino)butyl]naphthalen-1-yl]-3-methylbutanamide (PubChem CID 21127174) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)butyl]naphthalen-1-yl]-3-methylbutanamide.
| Compound Name | 2-[2-[4-(dimethylamino)butyl]naphthalen-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 21127174 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 2-[2-[4-(dimethylamino)butyl]naphthalen-1-yl]-3-methylbutanamide |
| SMILES | CC(C)C(C(N)=O)c1c(CCCCN(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C21H30N2O/c1-15(2)19(21(22)24)20-17(10-7-8-14-23(3)4)13-12-16-9-5-6-11-18(16)20/h5-6,9,11-13,15,19H,7-8,10,14H2,1-4H3,(H2,22,24) |
| InChIKey | ITLNYGODAMCWQC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|