C22H30N2O — CID 21117750
3-methyl-2-[2-(2-piperidin-1-ylethyl)naphthalen-1-yl]butanamide (PubChem CID 21117750) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 3-methyl-2-[2-(2-piperidin-1-ylethyl)naphthalen-1-yl]butanamide.
| Compound Name | 3-methyl-2-[2-(2-piperidin-1-ylethyl)naphthalen-1-yl]butanamide |
|---|---|
| PubChem CID | 21117750 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 3-methyl-2-[2-(2-piperidin-1-ylethyl)naphthalen-1-yl]butanamide |
| SMILES | CC(C)C(C(N)=O)c1c(CCN2CCCCC2)ccc2ccccc12 |
| InChI | InChI=1S/C22H30N2O/c1-16(2)20(22(23)25)21-18(12-15-24-13-6-3-7-14-24)11-10-17-8-4-5-9-19(17)21/h4-5,8-11,16,20H,3,6-7,12-15H2,1-2H3,(H2,23,25) |
| InChIKey | BOCLVUIUDYTKLG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |