C29H40N4O2 — CID 91391811
2-phenyl-N'-(2-piperidin-1-ylethyl)-3-[2-(2-pyrrolidin-1-ylethyl)phenyl]butanediamide (PubChem CID 91391811) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 2-phenyl-N'-(2-piperidin-1-ylethyl)-3-[2-(2-pyrrolidin-1-ylethyl)phenyl]butanediamide.
| Compound Name | 2-phenyl-N'-(2-piperidin-1-ylethyl)-3-[2-(2-pyrrolidin-1-ylethyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 91391811 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 2-phenyl-N'-(2-piperidin-1-ylethyl)-3-[2-(2-pyrrolidin-1-ylethyl)phenyl]butanediamide |
| SMILES | NC(=O)C(c1ccccc1)C(C(=O)NCCN1CCCCC1)c1ccccc1CCN1CCCC1 |
| InChI | InChI=1S/C29H40N4O2/c30-28(34)26(24-12-3-1-4-13-24)27(29(35)31-16-22-33-17-7-2-8-18-33)25-14-6-5-11-23(25)15-21-32-19-9-10-20-32/h1,3-6,11-14,26-27H,2,7-10,15-22H2,(H2,30,34)(H,31,35) |
| InChIKey | RHOGUVGDHVNTPB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |