C22H16F3N3O — CID 174626568
8-anilino-5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde (PubChem CID 174626568) has the molecular formula C22H16F3N3O and a molecular weight of 395.38 g/mol. Its IUPAC name is 8-anilino-5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde.
| Compound Name | 8-anilino-5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174626568 |
| Molecular Formula | C22H16F3N3O |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 8-anilino-5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
| SMILES | O=CC1NC=Cc2c(-c3cccc(C(F)(F)F)c3)cnc(Nc3ccccc3)c21 |
| InChI | InChI=1S/C22H16F3N3O/c23-22(24,25)15-6-4-5-14(11-15)18-12-27-21(28-16-7-2-1-3-8-16)20-17(18)9-10-26-19(20)13-29/h1-13,19,26H,(H,27,28) |
| InChIKey | IGRGZJDFWWOUNA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|