C25H24N4O2 — CID 174626645
8-(4-morpholin-4-ylanilino)-6-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde (PubChem CID 174626645) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 8-(4-morpholin-4-ylanilino)-6-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde.
| Compound Name | 8-(4-morpholin-4-ylanilino)-6-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174626645 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 8-(4-morpholin-4-ylanilino)-6-phenyl-1,2-dihydro-2,7-naphthyridine-1-carbaldehyde |
| SMILES | O=CC1NC=Cc2cc(-c3ccccc3)nc(Nc3ccc(N4CCOCC4)cc3)c21 |
| InChI | InChI=1S/C25H24N4O2/c30-17-23-24-19(10-11-26-23)16-22(18-4-2-1-3-5-18)28-25(24)27-20-6-8-21(9-7-20)29-12-14-31-15-13-29/h1-11,16-17,23,26H,12-15H2,(H,27,28) |
| InChIKey | CZVNBJINMHZBHO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|