C21H25N5O2 — CID 44180013
6-(3-aminopropyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 44180013) has the molecular formula C21H25N5O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 6-(3-aminopropyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(3-aminopropyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 44180013 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 6-(3-aminopropyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | C1COCCN1C2=CC=C(C=C2)NC3=C4C(=CC(=N3)CCCN)C=CNC4=O |
| InChI | InChI=1S/C21H25N5O2/c22-8-1-2-17-14-15-7-9-23-21(27)19(15)20(25-17)24-16-3-5-18(6-4-16)26-10-12-28-13-11-26/h3-7,9,14H,1-2,8,10-13,22H2,(H,23,27)(H,24,25) |
| InChIKey | MKILIVUEQNFIIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 543 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|