C21H21BrN4O2 — CID 59375592
9-bromo-4-[(3S)-3-hydroxybut-1-ynyl]-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 59375592) has the molecular formula C21H21BrN4O2 and a molecular weight of 441.33 g/mol. Its IUPAC name is 9-bromo-4-[(3S)-3-hydroxybut-1-ynyl]-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-bromo-4-[(3S)-3-hydroxybut-1-ynyl]-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59375592 |
| Molecular Formula | C21H21BrN4O2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 9-bromo-4-[(3S)-3-hydroxybut-1-ynyl]-6-[[(3S)-piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | C[C@H](O)C#Cc1c[nH]c(=O)c2c1nc(N[C@H]1CCCNC1)c1ccc(Br)cc12 |
| InChI | InChI=1S/C21H21BrN4O2/c1-12(27)4-5-13-10-24-21(28)18-17-9-14(22)6-7-16(17)20(26-19(13)18)25-15-3-2-8-23-11-15/h6-7,9-10,12,15,23,27H,2-3,8,11H2,1H3,(H,24,28)(H,25,26)/t12-,15-/m0/s1 |
| InChIKey | VUNPHHKSNGHCLO-WFASDCNBSA-N |
| XLogP | 2.73 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|