C26H22BrIN6O — CID 91331963
9-bromo-4-iodo-6-[[(3S)-1-(4-methylcinnolin-3-yl)piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 91331963) has the molecular formula C26H22BrIN6O and a molecular weight of 641.31 g/mol. Its IUPAC name is 9-bromo-4-iodo-6-[[(3S)-1-(4-methylcinnolin-3-yl)piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-bromo-4-iodo-6-[[(3S)-1-(4-methylcinnolin-3-yl)piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 91331963 |
| Molecular Formula | C26H22BrIN6O |
| Molecular Weight | 641.31 g/mol |
| Exact Mass | 640.01 |
| IUPAC Name | 9-bromo-4-iodo-6-[[(3S)-1-(4-methylcinnolin-3-yl)piperidin-3-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | Cc1c(N2CCC[C@H](Nc3nc4c(I)c[nH]c(=O)c4c4cc(Br)ccc34)C2)nnc2ccccc12 |
| InChI | InChI=1S/C26H22BrIN6O/c1-14-17-6-2-3-7-21(17)32-33-25(14)34-10-4-5-16(13-34)30-24-18-9-8-15(27)11-19(18)22-23(31-24)20(28)12-29-26(22)35/h2-3,6-9,11-12,16H,4-5,10,13H2,1H3,(H,29,35)(H,30,31)/t16-/m0/s1 |
| InChIKey | PVFPFANPYDNGOT-INIZCTEOSA-N |
| XLogP | 5.78 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|