C26H24BrIN4O3 — CID 67416562
(3S)-N-(9-bromo-4-iodo-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl)-1-[(4-methoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 67416562) has the molecular formula C26H24BrIN4O3 and a molecular weight of 647.31 g/mol. Its IUPAC name is (3S)-N-(9-bromo-4-iodo-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl)-1-[(4-methoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(9-bromo-4-iodo-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl)-1-[(4-methoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67416562 |
| Molecular Formula | C26H24BrIN4O3 |
| Molecular Weight | 647.31 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | (3S)-N-(9-bromo-4-iodo-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl)-1-[(4-methoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CN2CCC[C@H](C(=O)Nc3nc4c(I)c[nH]c(=O)c4c4cc(Br)ccc34)C2)cc1 |
| InChI | InChI=1S/C26H24BrIN4O3/c1-35-18-7-4-15(5-8-18)13-32-10-2-3-16(14-32)25(33)31-24-19-9-6-17(27)11-20(19)22-23(30-24)21(28)12-29-26(22)34/h4-9,11-12,16H,2-3,10,13-14H2,1H3,(H,29,34)(H,30,31,33)/t16-/m0/s1 |
| InChIKey | GVTNRKUSNUEZAP-INIZCTEOSA-N |
| XLogP | 5.30 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|