C21H18FN3O3S — CID 25225651
5-(2,4-dimethyl-5-methylsulfonylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 25225651) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is 5-(2,4-dimethyl-5-methylsulfonylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 5-(2,4-dimethyl-5-methylsulfonylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25225651 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-(2,4-dimethyl-5-methylsulfonylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | Cc1cc(C)c(S(C)(=O)=O)cc1Nc1nc2ccc(F)cc2c2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C21H18FN3O3S/c1-11-8-12(2)18(29(3,27)28)10-17(11)25-20-14-6-7-23-21(26)19(14)15-9-13(22)4-5-16(15)24-20/h4-10H,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | JWNIAIKEFBGEAT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|