C23H21FN4OS — CID 143777576
5-[5-(cyclopropylamino)sulfanyl-2,4-dimethylanilino]-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 143777576) has the molecular formula C23H21FN4OS and a molecular weight of 420.51 g/mol. Its IUPAC name is 5-[5-(cyclopropylamino)sulfanyl-2,4-dimethylanilino]-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 5-[5-(cyclopropylamino)sulfanyl-2,4-dimethylanilino]-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 143777576 |
| Molecular Formula | C23H21FN4OS |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-[5-(cyclopropylamino)sulfanyl-2,4-dimethylanilino]-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | Cc1cc(C)c(SNC2CC2)cc1Nc1nc2ccc(F)cc2c2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C23H21FN4OS/c1-12-9-13(2)20(30-28-15-4-5-15)11-19(12)27-22-16-7-8-25-23(29)21(16)17-10-14(24)3-6-18(17)26-22/h3,6-11,15,28H,4-5H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | JHAIVCIIWVGFDT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|