C26H22BF2N3O3 — CID 58000828
4-(2,6-difluorophenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 58000828) has the molecular formula C26H22BF2N3O3 and a molecular weight of 473.29 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-(2,6-difluorophenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 58000828 |
| Molecular Formula | C26H22BF2N3O3 |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-(2,6-difluorophenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2c(=O)[nH]ccc2c2nc(-c4c(F)cccc4F)[nH]c32)OC1(C)C |
| InChI | InChI=1S/C26H22BF2N3O3/c1-25(2)26(3,4)35-27(34-25)13-8-9-14-16(12-13)19-15(10-11-30-24(19)33)22-21(14)31-23(32-22)20-17(28)6-5-7-18(20)29/h5-12H,1-4H3,(H,30,33)(H,31,32) |
| InChIKey | ZUXVQCNTWYCGOK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|