C22H17ClFN5O3S — CID 24887119
4-(2-chloro-6-fluorophenyl)-15-(dimethylsulfamoylamino)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaene (PubChem CID 24887119) has the molecular formula C22H17ClFN5O3S and a molecular weight of 485.93 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-15-(dimethylsulfamoylamino)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaene.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-15-(dimethylsulfamoylamino)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaene |
|---|---|
| PubChem CID | 24887119 |
| Molecular Formula | C22H17ClFN5O3S |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-15-(dimethylsulfamoylamino)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaene |
| SMILES | CN(C)S(=O)(=O)Nc1ccc2c(c1)c1c(=O)[nH]ccc1c1nc(-c3c(F)cccc3Cl)[nH]c21 |
| InChI | InChI=1S/C22H17ClFN5O3S/c1-29(2)33(31,32)28-11-6-7-12-14(10-11)17-13(8-9-25-22(17)30)20-19(12)26-21(27-20)18-15(23)4-3-5-16(18)24/h3-10,28H,1-2H3,(H,25,30)(H,26,27) |
| InChIKey | LJKYOPKSENLSRS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|