C24H14ClF4IN2O — CID 87656802
2-[2-(2-chloro-6-fluorophenyl)-6-iodo-1H-phenanthro[9,10-d]imidazol-9-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 87656802) has the molecular formula C24H14ClF4IN2O and a molecular weight of 584.74 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)-6-iodo-1H-phenanthro[9,10-d]imidazol-9-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)-6-iodo-1H-phenanthro[9,10-d]imidazol-9-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87656802 |
| Molecular Formula | C24H14ClF4IN2O |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 583.98 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)-6-iodo-1H-phenanthro[9,10-d]imidazol-9-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc2c(c1)c1cc(I)ccc1c1nc(-c3c(F)cccc3Cl)[nH]c21)C(F)(F)F |
| InChI | InChI=1S/C24H14ClF4IN2O/c1-23(33,24(27,28)29)11-5-7-13-15(9-11)16-10-12(30)6-8-14(16)21-20(13)31-22(32-21)19-17(25)3-2-4-18(19)26/h2-10,33H,1H3,(H,31,32) |
| InChIKey | UNAIRLSDKSMKJH-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|