C15H9ClFN7 — CID 67382661
8-(2-chloro-6-fluorophenyl)-N-pyridazin-3-yl-7H-purin-6-amine (PubChem CID 67382661) has the molecular formula C15H9ClFN7 and a molecular weight of 341.74 g/mol. Its IUPAC name is 8-(2-chloro-6-fluorophenyl)-N-pyridazin-3-yl-7H-purin-6-amine.
| Compound Name | 8-(2-chloro-6-fluorophenyl)-N-pyridazin-3-yl-7H-purin-6-amine |
|---|---|
| PubChem CID | 67382661 |
| Molecular Formula | C15H9ClFN7 |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 8-(2-chloro-6-fluorophenyl)-N-pyridazin-3-yl-7H-purin-6-amine |
| SMILES | Fc1cccc(Cl)c1-c1nc2ncnc(Nc3cccnn3)c2[nH]1 |
| InChI | InChI=1S/C15H9ClFN7/c16-8-3-1-4-9(17)11(8)13-22-12-14(18-7-19-15(12)23-13)21-10-5-2-6-20-24-10/h1-7H,(H2,18,19,21,22,23,24) |
| InChIKey | LALCGTUXZJAYNR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |