C16H8Cl2N8 — CID 67383519
5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile (PubChem CID 67383519) has the molecular formula C16H8Cl2N8 and a molecular weight of 383.20 g/mol. Its IUPAC name is 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 67383519 |
| Molecular Formula | C16H8Cl2N8 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ncnc3nc(-c4c(Cl)cccc4Cl)[nH]c23)cn1 |
| InChI | InChI=1S/C16H8Cl2N8/c17-9-2-1-3-10(18)12(9)14-25-13-15(22-7-23-16(13)26-14)24-11-6-20-8(4-19)5-21-11/h1-3,5-7H,(H2,21,22,23,24,25,26) |
| InChIKey | VHWKAZASSZANQO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |