About 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile
5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile (PubChem CID 67383519) has the molecular formula C16H8Cl2N8
and a molecular weight of 383.20 g/mol. Its IUPAC name is 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile |
| PubChem CID | 67383519 |
| Molecular Formula | C16H8Cl2N8 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ncnc3nc(-c4c(Cl)cccc4Cl)[nH]c23)cn1 |
| InChI | InChI=1S/C16H8Cl2N8/c17-9-2-1-3-10(18)12(9)14-25-13-15(22-7-23-16(13)26-14)24-11-6-20-8(4-19)5-21-11/h1-3,5-7H,(H2,21,22,23,24,25,26) |
| InChIKey | VHWKAZASSZANQO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile?
The IUPAC name of 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile (CID 67383519) is 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile.
What is the SMILES notation for 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile?
The canonical SMILES for 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile is N#Cc1cnc(Nc2ncnc3nc(-c4c(Cl)cccc4Cl)[nH]c23)cn1.
What is the InChIKey of 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile?
The InChIKey is VHWKAZASSZANQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl2N8/c17-9-2-1-3-10(18)12(9)14-25-13-15(22-7-23-16(13)26-14)24-11-6-20-8(4-19)5-21-11/h1-3,5-7H,(H2,21,22,23,24,25,26).
What are the key properties of 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile?
5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile has a molecular weight of 383.20 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[8-(2,6-dichlorophenyl)-7H-purin-6-yl]amino]pyrazine-2-carbonitrile is sourced from PubChem (CID 67383519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).