C13H10Cl2N6O — CID 67383980
1-[8-(2,6-dichlorophenyl)-7H-purin-6-yl]-3-methylurea (PubChem CID 67383980) has the molecular formula C13H10Cl2N6O and a molecular weight of 337.17 g/mol. Its IUPAC name is 1-[8-(2,6-dichlorophenyl)-7H-purin-6-yl]-3-methylurea.
| Compound Name | 1-[8-(2,6-dichlorophenyl)-7H-purin-6-yl]-3-methylurea |
|---|---|
| PubChem CID | 67383980 |
| Molecular Formula | C13H10Cl2N6O |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 1-[8-(2,6-dichlorophenyl)-7H-purin-6-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ncnc2nc(-c3c(Cl)cccc3Cl)[nH]c12 |
| InChI | InChI=1S/C13H10Cl2N6O/c1-16-13(22)21-12-9-11(17-5-18-12)20-10(19-9)8-6(14)3-2-4-7(8)15/h2-5H,1H3,(H3,16,17,18,19,20,21,22) |
| InChIKey | XRZGJMWGRVDZNG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |