C16H17N5O — CID 117092303
1-[3-[6-(propylamino)-7H-purin-8-yl]phenyl]ethanone (PubChem CID 117092303) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-[3-[6-(propylamino)-7H-purin-8-yl]phenyl]ethanone.
| Compound Name | 1-[3-[6-(propylamino)-7H-purin-8-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 117092303 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[3-[6-(propylamino)-7H-purin-8-yl]phenyl]ethanone |
| SMILES | CCCNc1ncnc2nc(-c3cccc(C(C)=O)c3)[nH]c12 |
| InChI | InChI=1S/C16H17N5O/c1-3-7-17-15-13-16(19-9-18-15)21-14(20-13)12-6-4-5-11(8-12)10(2)22/h4-6,8-9H,3,7H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | HTACSZWMZJCMOK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |