C15H9ClF2N8 — CID 67383690
4-N-[8-(2-chloro-3,6-difluorophenyl)-7H-purin-6-yl]pyrimidine-4,6-diamine (PubChem CID 67383690) has the molecular formula C15H9ClF2N8 and a molecular weight of 374.74 g/mol. Its IUPAC name is 4-N-[8-(2-chloro-3,6-difluorophenyl)-7H-purin-6-yl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[8-(2-chloro-3,6-difluorophenyl)-7H-purin-6-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 67383690 |
| Molecular Formula | C15H9ClF2N8 |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-N-[8-(2-chloro-3,6-difluorophenyl)-7H-purin-6-yl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(Nc2ncnc3nc(-c4c(F)ccc(F)c4Cl)[nH]c23)ncn1 |
| InChI | InChI=1S/C15H9ClF2N8/c16-11-7(18)2-1-6(17)10(11)13-25-12-14(22-5-23-15(12)26-13)24-9-3-8(19)20-4-21-9/h1-5H,(H4,19,20,21,22,23,24,25,26) |
| InChIKey | PRQXYSMBXHVSSZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|