C18H12Cl2N8 — CID 53476790
3,5-dichloro-4-[6-[(5-ethylpyrazin-2-yl)amino]-7H-purin-8-yl]benzonitrile (PubChem CID 53476790) has the molecular formula C18H12Cl2N8 and a molecular weight of 411.26 g/mol. Its IUPAC name is 3,5-dichloro-4-[6-[(5-ethylpyrazin-2-yl)amino]-7H-purin-8-yl]benzonitrile.
| Compound Name | 3,5-dichloro-4-[6-[(5-ethylpyrazin-2-yl)amino]-7H-purin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 53476790 |
| Molecular Formula | C18H12Cl2N8 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 3,5-dichloro-4-[6-[(5-ethylpyrazin-2-yl)amino]-7H-purin-8-yl]benzonitrile |
| SMILES | CCc1cnc(Nc2ncnc3nc(-c4c(Cl)cc(C#N)cc4Cl)[nH]c23)cn1 |
| InChI | InChI=1S/C18H12Cl2N8/c1-2-10-6-23-13(7-22-10)26-17-15-18(25-8-24-17)28-16(27-15)14-11(19)3-9(5-21)4-12(14)20/h3-4,6-8H,2H2,1H3,(H2,23,24,25,26,27,28) |
| InChIKey | WBMMMJFUIGGVIO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |