C11H11ClFN3 — CID 82292580
[2-(2-chloro-6-fluorophenyl)-5-methyl-1H-imidazol-4-yl]methanamine (PubChem CID 82292580) has the molecular formula C11H11ClFN3 and a molecular weight of 239.68 g/mol. Its IUPAC name is [2-(2-chloro-6-fluorophenyl)-5-methyl-1H-imidazol-4-yl]methanamine.
| Compound Name | [2-(2-chloro-6-fluorophenyl)-5-methyl-1H-imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82292580 |
| Molecular Formula | C11H11ClFN3 |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | [2-(2-chloro-6-fluorophenyl)-5-methyl-1H-imidazol-4-yl]methanamine |
| SMILES | Cc1[nH]c(-c2c(F)cccc2Cl)nc1CN |
| InChI | InChI=1S/C11H11ClFN3/c1-6-9(5-14)16-11(15-6)10-7(12)3-2-4-8(10)13/h2-4H,5,14H2,1H3,(H,15,16) |
| InChIKey | LFMOWEDCUVXRID-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |