C12H15N3O — CID 82285142
[2-(4-methoxyphenyl)-5-methyl-1H-imidazol-4-yl]methanamine (PubChem CID 82285142) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-5-methyl-1H-imidazol-4-yl]methanamine.
| Compound Name | [2-(4-methoxyphenyl)-5-methyl-1H-imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82285142 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | [2-(4-methoxyphenyl)-5-methyl-1H-imidazol-4-yl]methanamine |
| SMILES | COc1ccc(-c2nc(CN)c(C)[nH]2)cc1 |
| InChI | InChI=1S/C12H15N3O/c1-8-11(7-13)15-12(14-8)9-3-5-10(16-2)6-4-9/h3-6H,7,13H2,1-2H3,(H,14,15) |
| InChIKey | XJEHMBYRGMVWQY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |