C12H14Cl2N2O — CID 22412365
4-(chloromethyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole;hydrochloride (PubChem CID 22412365) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole;hydrochloride.
| Compound Name | 4-(chloromethyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 22412365 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-(chloromethyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole;hydrochloride |
| SMILES | COc1ccc(-c2nc(CCl)c(C)[nH]2)cc1.Cl |
| InChI | InChI=1S/C12H13ClN2O.ClH/c1-8-11(7-13)15-12(14-8)9-3-5-10(16-2)6-4-9;/h3-6H,7H2,1-2H3,(H,14,15);1H |
| InChIKey | CFXSWVYFJOUALP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|