C17H14Cl2N2O — CID 73332044
4-(2,3-dichlorophenyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole (PubChem CID 73332044) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole.
| Compound Name | 4-(2,3-dichlorophenyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 73332044 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-2-(4-methoxyphenyl)-5-methyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3cccc(Cl)c3Cl)c(C)[nH]2)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O/c1-10-16(13-4-3-5-14(18)15(13)19)21-17(20-10)11-6-8-12(22-2)9-7-11/h3-9H,1-2H3,(H,20,21) |
| InChIKey | MRLYQLQOAJHGDD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |