C13H11Cl2NO — CID 118813607
2-(2,3-dichlorophenyl)-4-methoxy-6-methylpyridine (PubChem CID 118813607) has the molecular formula C13H11Cl2NO and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4-methoxy-6-methylpyridine.
| Compound Name | 2-(2,3-dichlorophenyl)-4-methoxy-6-methylpyridine |
|---|---|
| PubChem CID | 118813607 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4-methoxy-6-methylpyridine |
| SMILES | COc1cc(C)nc(-c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO/c1-8-6-9(17-2)7-12(16-8)10-4-3-5-11(14)13(10)15/h3-7H,1-2H3 |
| InChIKey | NPWYERVPPFTASV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |