C26H21F4N5O4S — CID 67356635
2-(dimethylamino)-N-[3-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]phenyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 67356635) has the molecular formula C26H21F4N5O4S and a molecular weight of 575.54 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]phenyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dimethylamino)-N-[3-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67356635 |
| Molecular Formula | C26H21F4N5O4S |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CC(=O)Nc1cccc(Sc2nc3c4cc[nH]c(=O)c4c4cc(F)ccc4c3[nH]2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H20FN5O2S.C2HF3O2/c1-30(2)12-19(31)27-14-4-3-5-15(11-14)33-24-28-21-16-7-6-13(25)10-18(16)20-17(22(21)29-24)8-9-26-23(20)32;3-2(4,5)1(6)7/h3-11H,12H2,1-2H3,(H,26,32)(H,27,31)(H,28,29);(H,6,7) |
| InChIKey | ARRGRQAPUPCELU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|