C14H12F4N4O — CID 36723676
N-(3-fluorophenyl)-2-[methyl-[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide (PubChem CID 36723676) has the molecular formula C14H12F4N4O and a molecular weight of 328.27 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[methyl-[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[methyl-[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 36723676 |
| Molecular Formula | C14H12F4N4O |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-(3-fluorophenyl)-2-[methyl-[4-(trifluoromethyl)pyrimidin-2-yl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)c1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F4N4O/c1-22(13-19-6-5-11(21-13)14(16,17)18)8-12(23)20-10-4-2-3-9(15)7-10/h2-7H,8H2,1H3,(H,20,23) |
| InChIKey | PZCYVNXVFNSGLV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |