C20H19FN4O3S — CID 67357945
N-ethyl-2-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]-4-hydroxybutanamide (PubChem CID 67357945) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is N-ethyl-2-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]-4-hydroxybutanamide.
| Compound Name | N-ethyl-2-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 67357945 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-ethyl-2-[(15-fluoro-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-4-yl)sulfanyl]-4-hydroxybutanamide |
| SMILES | CCNC(=O)C(CCO)Sc1nc2c3cc[nH]c(=O)c3c3cc(F)ccc3c2[nH]1 |
| InChI | InChI=1S/C20H19FN4O3S/c1-2-22-18(27)14(6-8-26)29-20-24-16-11-4-3-10(21)9-13(11)15-12(17(16)25-20)5-7-23-19(15)28/h3-5,7,9,14,26H,2,6,8H2,1H3,(H,22,27)(H,23,28)(H,24,25) |
| InChIKey | FHXRMGHRAFPFDP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|