C18H8Cl2FN5OS — CID 87368531
4-(3,5-dichloropyridazin-4-yl)sulfanyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 87368531) has the molecular formula C18H8Cl2FN5OS and a molecular weight of 432.27 g/mol. Its IUPAC name is 4-(3,5-dichloropyridazin-4-yl)sulfanyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-(3,5-dichloropyridazin-4-yl)sulfanyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 87368531 |
| Molecular Formula | C18H8Cl2FN5OS |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 4-(3,5-dichloropyridazin-4-yl)sulfanyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | O=c1[nH]ccc2c3nc(Sc4c(Cl)cnnc4Cl)[nH]c3c3ccc(F)cc3c12 |
| InChI | InChI=1S/C18H8Cl2FN5OS/c19-11-6-23-26-16(20)15(11)28-18-24-13-8-2-1-7(21)5-10(8)12-9(14(13)25-18)3-4-22-17(12)27/h1-6H,(H,22,27)(H,24,25) |
| InChIKey | MMPQLTHDIQHKAM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|