C21H20FN5O2 — CID 68589193
15-fluoro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 68589193) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 15-fluoro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 68589193 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 15-fluoro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | O=C1CCCN1CCCNc1nc2c3cc[nH]c(=O)c3c3cc(F)ccc3c2[nH]1 |
| InChI | InChI=1S/C21H20FN5O2/c22-12-4-5-13-15(11-12)17-14(6-8-23-20(17)29)19-18(13)25-21(26-19)24-7-2-10-27-9-1-3-16(27)28/h4-6,8,11H,1-3,7,9-10H2,(H,23,29)(H2,24,25,26) |
| InChIKey | XLGDTQXOOFIBEF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|