C35H32ClN5O3 — CID 24885475
tert-butyl 4-[4-[4-(2-chlorophenyl)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-15-yl]phenyl]piperazine-1-carboxylate (PubChem CID 24885475) has the molecular formula C35H32ClN5O3 and a molecular weight of 606.13 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(2-chlorophenyl)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-15-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(2-chlorophenyl)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-15-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 24885475 |
| Molecular Formula | C35H32ClN5O3 |
| Molecular Weight | 606.13 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | tert-butyl 4-[4-[4-(2-chlorophenyl)-11-oxo-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-15-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-c3ccc4c(c3)c3c(=O)[nH]ccc3c3nc(-c5ccccc5Cl)[nH]c43)cc2)CC1 |
| InChI | InChI=1S/C35H32ClN5O3/c1-35(2,3)44-34(43)41-18-16-40(17-19-41)23-11-8-21(9-12-23)22-10-13-24-27(20-22)29-26(14-15-37-33(29)42)31-30(24)38-32(39-31)25-6-4-5-7-28(25)36/h4-15,20H,16-19H2,1-3H3,(H,37,42)(H,38,39) |
| InChIKey | FWPDTDFVWRLNAY-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.13 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|