C21H25BN2O2 — CID 101267745
2-[1H-pyrrol-2-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-pyrrole (PubChem CID 101267745) has the molecular formula C21H25BN2O2 and a molecular weight of 348.26 g/mol. Its IUPAC name is 2-[1H-pyrrol-2-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-pyrrole.
| Compound Name | 2-[1H-pyrrol-2-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 101267745 |
| Molecular Formula | C21H25BN2O2 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[1H-pyrrol-2-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1H-pyrrole |
| SMILES | CC1(C)OB(c2ccc(C(c3ccc[nH]3)c3ccc[nH]3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H25BN2O2/c1-20(2)21(3,4)26-22(25-20)16-11-9-15(10-12-16)19(17-7-5-13-23-17)18-8-6-14-24-18/h5-14,19,23-24H,1-4H3 |
| InChIKey | USFNUJSTDMBUDT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|