C12H17BN4O2 — CID 175179905
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 175179905) has the molecular formula C12H17BN4O2 and a molecular weight of 260.11 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175179905 |
| Molecular Formula | C12H17BN4O2 |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)OB(c2nc(N)c3cc[nH]c3n2)OC1(C)C |
| InChI | InChI=1S/C12H17BN4O2/c1-11(2)12(3,4)19-13(18-11)10-16-8(14)7-5-6-15-9(7)17-10/h5-6H,1-4H3,(H3,14,15,16,17) |
| InChIKey | WACJJRLYKXFZQH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|